C26H46O5Si2 — CID 14061534
(2R,4R,5R)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-phenyl-1,3-dioxane-4-carbaldehyde (PubChem CID 14061534) has the molecular formula C26H46O5Si2 and a molecular weight of 494.82 g/mol. Its IUPAC name is (2R,4R,5R)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-phenyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (2R,4R,5R)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-phenyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 14061534 |
| Molecular Formula | C26H46O5Si2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2R,4R,5R)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-phenyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CO[C@@H](c2ccccc2)O[C@H]1C=O |
| InChI | InChI=1S/C26H46O5Si2/c1-25(2,3)32(7,8)29-17-16-22(31-33(9,10)26(4,5)6)21-19-28-24(30-23(21)18-27)20-14-12-11-13-15-20/h11-15,18,21-24H,16-17,19H2,1-10H3/t21-,22-,23-,24+/m0/s1 |
| InChIKey | LQQGXIBIKLQBCV-NEWJYFPISA-N |
| XLogP | 6.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|