C21H34O4Si — CID 25023541
1-[(2S,4S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]propan-2-one (PubChem CID 25023541) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-[(2S,4S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]propan-2-one.
| Compound Name | 1-[(2S,4S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 25023541 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[(2S,4S,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C[C@H](CCO[Si](C)(C)C(C)(C)C)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H34O4Si/c1-16(22)14-19-15-18(12-13-23-26(5,6)21(2,3)4)24-20(25-19)17-10-8-7-9-11-17/h7-11,18-20H,12-15H2,1-6H3/t18-,19+,20-/m0/s1 |
| InChIKey | HWMXXORLCXPYSM-ZCNNSNEGSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|