C22H33FO4 — CID 134925023
6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one (PubChem CID 134925023) has the molecular formula C22H33FO4 and a molecular weight of 380.50 g/mol. Its IUPAC name is 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one.
| Compound Name | 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 134925023 |
| Molecular Formula | C22H33FO4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one |
| SMILES | CC(C)(C)C(=O)CC(OC1CCCCO1)C(C)(F)COCc1ccccc1 |
| InChI | InChI=1S/C22H33FO4/c1-21(2,3)18(24)14-19(27-20-12-8-9-13-26-20)22(4,23)16-25-15-17-10-6-5-7-11-17/h5-7,10-11,19-20H,8-9,12-16H2,1-4H3 |
| InChIKey | CJBMJUKZLPGCGN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |