C30H44O8Si — CID 11103700
[(3R,4S,6R)-6-[6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]-3-phenylmethoxyhept-1-en-4-yl] acetate (PubChem CID 11103700) has the molecular formula C30H44O8Si and a molecular weight of 560.76 g/mol. Its IUPAC name is [(3R,4S,6R)-6-[6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]-3-phenylmethoxyhept-1-en-4-yl] acetate.
| Compound Name | [(3R,4S,6R)-6-[6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]-3-phenylmethoxyhept-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 11103700 |
| Molecular Formula | C30H44O8Si |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | [(3R,4S,6R)-6-[6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]-3-phenylmethoxyhept-1-en-4-yl] acetate |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](C[C@@H](C)C1OC(CO[Si](C)(C)C(C)(C)C)(OC(C)=O)C=CC1=O)OC(C)=O |
| InChI | InChI=1S/C30H44O8Si/c1-10-26(34-19-24-14-12-11-13-15-24)27(36-22(3)31)18-21(2)28-25(33)16-17-30(38-28,37-23(4)32)20-35-39(8,9)29(5,6)7/h10-17,21,26-28H,1,18-20H2,2-9H3/t21-,26-,27+,28?,30?/m1/s1 |
| InChIKey | ZJWKYNBXMBQIPX-JSJFXPNJSA-N |
| XLogP | 5.52 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|