C32H56O10Si — CID 11490557
methyl (2R,3S)-4-[(2R,4S,5S,6S)-4,6-dimethoxy-6-(2-methyl-1-phenylmethoxypropan-2-yl)-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate (PubChem CID 11490557) has the molecular formula C32H56O10Si and a molecular weight of 628.88 g/mol. Its IUPAC name is methyl (2R,3S)-4-[(2R,4S,5S,6S)-4,6-dimethoxy-6-(2-methyl-1-phenylmethoxypropan-2-yl)-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate.
| Compound Name | methyl (2R,3S)-4-[(2R,4S,5S,6S)-4,6-dimethoxy-6-(2-methyl-1-phenylmethoxypropan-2-yl)-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate |
|---|---|
| PubChem CID | 11490557 |
| Molecular Formula | C32H56O10Si |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | methyl (2R,3S)-4-[(2R,4S,5S,6S)-4,6-dimethoxy-6-(2-methyl-1-phenylmethoxypropan-2-yl)-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](OC)C[C@@H](C[C@H](OC)[C@@H](OCOC)C(=O)OC)O[C@@]1(OC)C(C)(C)COCc1ccccc1 |
| InChI | InChI=1S/C32H56O10Si/c1-11-43(12-2,13-3)42-29-27(36-8)20-25(19-26(35-7)28(30(33)37-9)40-23-34-6)41-32(29,38-10)31(4,5)22-39-21-24-17-15-14-16-18-24/h14-18,25-29H,11-13,19-23H2,1-10H3/t25-,26+,27+,28-,29+,32-/m1/s1 |
| InChIKey | JOOWCBDIJWRVNC-JXGZGSDJSA-N |
| XLogP | 5.33 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|