C25H42O9SSi — CID 102307843
methyl 2-[(4R,5R,6S)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-5-methylsulfonyloxy-1,3-dioxan-4-yl]acetate (PubChem CID 102307843) has the molecular formula C25H42O9SSi and a molecular weight of 546.76 g/mol. Its IUPAC name is methyl 2-[(4R,5R,6S)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-5-methylsulfonyloxy-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,5R,6S)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-5-methylsulfonyloxy-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 102307843 |
| Molecular Formula | C25H42O9SSi |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | methyl 2-[(4R,5R,6S)-6-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-5-methylsulfonyloxy-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1OC(C)(C)O[C@@H]([C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C25H42O9SSi/c1-24(2,3)36(9,10)34-20(17-14-12-11-13-15-17)22(30-7)23-21(33-35(8,27)28)18(16-19(26)29-6)31-25(4,5)32-23/h11-15,18,20-23H,16H2,1-10H3/t18-,20-,21-,22+,23-/m1/s1 |
| InChIKey | HFNKNOLGMVPKOV-FUBOCBINSA-N |
| XLogP | 4.19 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|