C31H56O8Si2 — CID 11296464
methyl (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-phenyl-1,3-dioxan-4-yl]-4-(methoxymethoxy)butanoate (PubChem CID 11296464) has the molecular formula C31H56O8Si2 and a molecular weight of 612.95 g/mol. Its IUPAC name is methyl (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-phenyl-1,3-dioxan-4-yl]-4-(methoxymethoxy)butanoate.
| Compound Name | methyl (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-phenyl-1,3-dioxan-4-yl]-4-(methoxymethoxy)butanoate |
|---|---|
| PubChem CID | 11296464 |
| Molecular Formula | C31H56O8Si2 |
| Molecular Weight | 612.95 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | methyl (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-phenyl-1,3-dioxan-4-yl]-4-(methoxymethoxy)butanoate |
| SMILES | COCO[C@H]([C@H]1OC(C)(C)O[C@H](c2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C)[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O8Si2/c1-29(2,3)40(11,12)38-23(20-24(32)34-10)26(35-21-33-9)27-28(39-41(13,14)30(4,5)6)25(36-31(7,8)37-27)22-18-16-15-17-19-22/h15-19,23,25-28H,20-21H2,1-14H3/t23-,25-,26+,27-,28-/m1/s1 |
| InChIKey | UHSHRZHQNRRXFU-TWHDSSIESA-N |
| XLogP | 7.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.95 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|