C15H20O8S — CID 134837501
[(2S,3R,4R)-4-hydroxy-2-[(1S,2R)-2-hydroxy-1-methoxy-2-phenylethyl]-6-oxooxan-3-yl] methanesulfonate (PubChem CID 134837501) has the molecular formula C15H20O8S and a molecular weight of 360.38 g/mol. Its IUPAC name is [(2S,3R,4R)-4-hydroxy-2-[(1S,2R)-2-hydroxy-1-methoxy-2-phenylethyl]-6-oxooxan-3-yl] methanesulfonate.
| Compound Name | [(2S,3R,4R)-4-hydroxy-2-[(1S,2R)-2-hydroxy-1-methoxy-2-phenylethyl]-6-oxooxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 134837501 |
| Molecular Formula | C15H20O8S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [(2S,3R,4R)-4-hydroxy-2-[(1S,2R)-2-hydroxy-1-methoxy-2-phenylethyl]-6-oxooxan-3-yl] methanesulfonate |
| SMILES | CO[C@H]([C@@H]1OC(=O)C[C@@H](O)[C@H]1OS(C)(=O)=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H20O8S/c1-21-14(12(18)9-6-4-3-5-7-9)15-13(23-24(2,19)20)10(16)8-11(17)22-15/h3-7,10,12-16,18H,8H2,1-2H3/t10-,12-,13-,14+,15-/m1/s1 |
| InChIKey | NLPXEESUGVXUIV-DVLUHMITSA-N |
| XLogP | -0.24 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|