C22H36O5Si — CID 178184643
ethyl 2-[(2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxan-2-yl]acetate (PubChem CID 178184643) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is ethyl 2-[(2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 178184643 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ethyl 2-[(2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@H](OCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)CO1 |
| InChI | InChI=1S/C22H36O5Si/c1-7-24-21(23)14-18-13-19(26-15-17-11-9-8-10-12-17)20(16-25-18)27-28(5,6)22(2,3)4/h8-12,18-20H,7,13-16H2,1-6H3/t18-,19-,20-/m0/s1 |
| InChIKey | DBNDQEIVWQMRBW-UFYCRDLUSA-N |
| XLogP | 4.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|