C14H18O5 — CID 162983830
methyl 2-[(2R,4S,5S,6S)-4,5-dihydroxy-6-phenyloxan-2-yl]acetate (PubChem CID 162983830) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl 2-[(2R,4S,5S,6S)-4,5-dihydroxy-6-phenyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4S,5S,6S)-4,5-dihydroxy-6-phenyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 162983830 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl 2-[(2R,4S,5S,6S)-4,5-dihydroxy-6-phenyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H](O)[C@H](O)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H18O5/c1-18-12(16)8-10-7-11(15)13(17)14(19-10)9-5-3-2-4-6-9/h2-6,10-11,13-15,17H,7-8H2,1H3/t10-,11+,13+,14+/m1/s1 |
| InChIKey | KDINCHVBSLYDMN-XWUBHJNHSA-N |
| XLogP | 0.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |