C36H51F3O9SSi — CID 10985512
methyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-[(2S,3R,5S,6R)-6-methyl-3,5-bis(phenylmethoxy)-6-[2-(trifluoromethylsulfonyloxy)prop-2-enyl]oxan-2-yl]butanoate (PubChem CID 10985512) has the molecular formula C36H51F3O9SSi and a molecular weight of 744.94 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-[(2S,3R,5S,6R)-6-methyl-3,5-bis(phenylmethoxy)-6-[2-(trifluoromethylsulfonyloxy)prop-2-enyl]oxan-2-yl]butanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-[(2S,3R,5S,6R)-6-methyl-3,5-bis(phenylmethoxy)-6-[2-(trifluoromethylsulfonyloxy)prop-2-enyl]oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 10985512 |
| Molecular Formula | C36H51F3O9SSi |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-[(2S,3R,5S,6R)-6-methyl-3,5-bis(phenylmethoxy)-6-[2-(trifluoromethylsulfonyloxy)prop-2-enyl]oxan-2-yl]butanoate |
| SMILES | C=C(C[C@@]1(C)O[C@@H](CC(C)(CC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@H](OCc2ccccc2)C[C@@H]1OCc1ccccc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C36H51F3O9SSi/c1-26(47-49(41,42)36(37,38)39)21-35(6)31(45-25-28-18-14-11-15-19-28)20-29(44-24-27-16-12-10-13-17-27)30(46-35)22-34(5,23-32(40)43-7)48-50(8,9)33(2,3)4/h10-19,29-31H,1,20-25H2,2-9H3/t29-,30+,31+,34?,35-/m1/s1 |
| InChIKey | YQJQDHWXRDCEFB-PSLAYBBVSA-N |
| XLogP | 8.21 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|