C31H35F3O9SSi — CID 10842150
[(3R,4R,5R,6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-hydroxy-2-oxo-5-phenylmethoxyoxan-3-yl] trifluoromethanesulfonate (PubChem CID 10842150) has the molecular formula C31H35F3O9SSi and a molecular weight of 668.76 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-hydroxy-2-oxo-5-phenylmethoxyoxan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,4R,5R,6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-hydroxy-2-oxo-5-phenylmethoxyoxan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10842150 |
| Molecular Formula | C31H35F3O9SSi |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | [(3R,4R,5R,6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-hydroxy-2-oxo-5-phenylmethoxyoxan-3-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@H]1OC(=O)[C@H](OS(=O)(=O)C(F)(F)F)[C@H](O)[C@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35F3O9SSi/c1-30(2,3)45(22-15-9-5-10-16-22,23-17-11-6-12-18-23)41-20-24(35)26-27(40-19-21-13-7-4-8-14-21)25(36)28(29(37)42-26)43-44(38,39)31(32,33)34/h4-18,24-28,35-36H,19-20H2,1-3H3/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | UHYXHOZTJPOFRI-JQPIIJRMSA-N |
| XLogP | 3.03 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|