C37H72O6Si3 — CID 135027516
benzyl (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate (PubChem CID 135027516) has the molecular formula C37H72O6Si3 and a molecular weight of 697.24 g/mol. Its IUPAC name is benzyl (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate.
| Compound Name | benzyl (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate |
|---|---|
| PubChem CID | 135027516 |
| Molecular Formula | C37H72O6Si3 |
| Molecular Weight | 697.24 g/mol |
| Exact Mass | 696.46 |
| IUPAC Name | benzyl (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)OCc1ccccc1)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C37H72O6Si3/c1-17-46(18-2,19-3)43-33(37(11,39-12)26-23-27-41-44(13,14)35(5,6)7)28-32(42-45(15,16)36(8,9)10)30(4)34(38)40-29-31-24-21-20-22-25-31/h20-22,24-25,30,32-33H,17-19,23,26-29H2,1-16H3/t30-,32+,33-,37-/m1/s1 |
| InChIKey | UUAOMUKNGRKARG-LPTKUCIESA-N |
| XLogP | 10.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.24 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|