C28H50O7Si2 — CID 10940654
methyl (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetate (PubChem CID 10940654) has the molecular formula C28H50O7Si2 and a molecular weight of 554.87 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetate.
| Compound Name | methyl (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 10940654 |
| Molecular Formula | C28H50O7Si2 |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | methyl (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetate |
| SMILES | COC(=O)[C@@](O)(c1ccccc1)[C@H]1O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O7Si2/c1-19-21(34-36(10,11)26(2,3)4)22(31-8)23(35-37(12,13)27(5,6)7)24(33-19)28(30,25(29)32-9)20-17-15-14-16-18-20/h14-19,21-24,30H,1-13H3/t19-,21-,22-,23+,24+,28-/m1/s1 |
| InChIKey | YZWJVCCCSKEAGB-FXBPIYTNSA-N |
| XLogP | 5.63 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|