C27H48O6Si2 — CID 11060433
(2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetaldehyde (PubChem CID 11060433) has the molecular formula C27H48O6Si2 and a molecular weight of 524.85 g/mol. Its IUPAC name is (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetaldehyde.
| Compound Name | (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 11060433 |
| Molecular Formula | C27H48O6Si2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | (2R)-2-[(2S,3S,4R,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxy-6-methyloxan-2-yl]-2-hydroxy-2-phenylacetaldehyde |
| SMILES | CO[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[C@H]([C@@](O)(C=O)c2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O6Si2/c1-19-21(32-34(9,10)25(2,3)4)22(30-8)23(33-35(11,12)26(5,6)7)24(31-19)27(29,18-28)20-16-14-13-15-17-20/h13-19,21-24,29H,1-12H3/t19-,21-,22-,23+,24+,27-/m1/s1 |
| InChIKey | CSVKNCSIAUADAX-FEKSMNBOSA-N |
| XLogP | 5.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|