C14H16O6 — CID 11737567
(3R,3aS,5R,6S,7R,7aS)-3,6,7-trihydroxy-5-methyl-3-phenyl-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran-2-one (PubChem CID 11737567) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3R,3aS,5R,6S,7R,7aS)-3,6,7-trihydroxy-5-methyl-3-phenyl-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran-2-one.
| Compound Name | (3R,3aS,5R,6S,7R,7aS)-3,6,7-trihydroxy-5-methyl-3-phenyl-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 11737567 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3R,3aS,5R,6S,7R,7aS)-3,6,7-trihydroxy-5-methyl-3-phenyl-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran-2-one |
| SMILES | C[C@H]1O[C@H]2[C@@H](OC(=O)[C@@]2(O)c2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16O6/c1-7-9(15)10(16)11-12(19-7)14(18,13(17)20-11)8-5-3-2-4-6-8/h2-7,9-12,15-16,18H,1H3/t7-,9-,10-,11+,12+,14-/m1/s1 |
| InChIKey | WNCNBZCZLGQFPC-IULQHKIBSA-N |
| XLogP | -0.69 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |