C24H42O4Si2 — CID 101462343
(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenyloxan-4-one (PubChem CID 101462343) has the molecular formula C24H42O4Si2 and a molecular weight of 450.77 g/mol. Its IUPAC name is (2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenyloxan-4-one.
| Compound Name | (2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenyloxan-4-one |
|---|---|
| PubChem CID | 101462343 |
| Molecular Formula | C24H42O4Si2 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenyloxan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](c2ccccc2)CC(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O4Si2/c1-23(2,3)29(7,8)26-17-21-22(28-30(9,10)24(4,5)6)19(25)16-20(27-21)18-14-12-11-13-15-18/h11-15,20-22H,16-17H2,1-10H3/t20-,21+,22-/m0/s1 |
| InChIKey | WTKYVQVWDSFFDB-BDTNDASRSA-N |
| XLogP | 6.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|