C30H43F3O7SSi — CID 11296620
[(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 11296620) has the molecular formula C30H43F3O7SSi and a molecular weight of 632.81 g/mol. Its IUPAC name is [(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11296620 |
| Molecular Formula | C30H43F3O7SSi |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | [(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](OCc2ccccc2)[C@@](C)(CCOCc2ccccc2)O[C@H]1COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C30H43F3O7SSi/c1-28(2,3)42(5,6)40-25-19-27(37-21-24-15-11-8-12-16-24)29(4,17-18-36-20-23-13-9-7-10-14-23)39-26(25)22-38-41(34,35)30(31,32)33/h7-16,25-27H,17-22H2,1-6H3/t25-,26+,27+,29-/m1/s1 |
| InChIKey | CDBGHEPTHIDMID-UYIZUTNXSA-N |
| XLogP | 6.98 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|