C27H44O3S2Si — CID 59051919
(4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentanal (PubChem CID 59051919) has the molecular formula C27H44O3S2Si and a molecular weight of 508.87 g/mol. Its IUPAC name is (4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentanal.
| Compound Name | (4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentanal |
|---|---|
| PubChem CID | 59051919 |
| Molecular Formula | C27H44O3S2Si |
| Molecular Weight | 508.87 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (4S)-5-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]-4-phenylmethoxypentanal |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1(C[C@H](CCC=O)OCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C27H44O3S2Si/c1-8-25(30-33(6,7)26(3,4)5)22(2)27(31-18-13-19-32-27)20-24(16-12-17-28)29-21-23-14-10-9-11-15-23/h8-11,14-15,17,22,24-25H,1,12-13,16,18-21H2,2-7H3/t22-,24+,25+/m1/s1 |
| InChIKey | OSRSETWKOOEROY-VJTSUQJLSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.87 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|