C27H48O3S2Si — CID 10929338
2-[(2S,3R,4S,6S)-6-[2,2-bis(ethylsulfanyl)ethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 10929338) has the molecular formula C27H48O3S2Si and a molecular weight of 512.90 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6S)-6-[2,2-bis(ethylsulfanyl)ethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2S,3R,4S,6S)-6-[2,2-bis(ethylsulfanyl)ethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10929338 |
| Molecular Formula | C27H48O3S2Si |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-[(2S,3R,4S,6S)-6-[2,2-bis(ethylsulfanyl)ethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CCSC(C[C@@H]1C[C@H](OCc2ccccc2)[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O1)SCC |
| InChI | InChI=1S/C27H48O3S2Si/c1-9-31-26(32-10-2)19-23-18-25(28-20-22-14-12-11-13-15-22)21(3)24(30-23)16-17-29-33(7,8)27(4,5)6/h11-15,21,23-26H,9-10,16-20H2,1-8H3/t21-,23-,24-,25-/m0/s1 |
| InChIKey | DNBLUXOAFJEMHM-LFBFJMOVSA-N |
| XLogP | 8.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.90 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|