C30H52O3Si — CID 11179313
[(2R)-2-[(2S,5S,6S)-5-methyl-6-[(E,2S)-5-phenylmethoxypent-3-en-2-yl]oxan-2-yl]propoxy]-tri(propan-2-yl)silane (PubChem CID 11179313) has the molecular formula C30H52O3Si and a molecular weight of 488.83 g/mol. Its IUPAC name is [(2R)-2-[(2S,5S,6S)-5-methyl-6-[(E,2S)-5-phenylmethoxypent-3-en-2-yl]oxan-2-yl]propoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2R)-2-[(2S,5S,6S)-5-methyl-6-[(E,2S)-5-phenylmethoxypent-3-en-2-yl]oxan-2-yl]propoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11179313 |
| Molecular Formula | C30H52O3Si |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | [(2R)-2-[(2S,5S,6S)-5-methyl-6-[(E,2S)-5-phenylmethoxypent-3-en-2-yl]oxan-2-yl]propoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H]1CC[C@H](C)[C@@H]([C@@H](C)/C=C/COCc2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H52O3Si/c1-22(2)34(23(3)4,24(5)6)32-20-27(9)29-18-17-26(8)30(33-29)25(7)14-13-19-31-21-28-15-11-10-12-16-28/h10-16,22-27,29-30H,17-21H2,1-9H3/b14-13+/t25-,26-,27+,29-,30+/m0/s1 |
| InChIKey | BTQLPPZSVPXZPG-ZUTBRBRBSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|