C28H46O3Si — CID 11037853
(4R,5S,6S)-2,2-ditert-butyl-4-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinane (PubChem CID 11037853) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (4R,5S,6S)-2,2-ditert-butyl-4-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinane.
| Compound Name | (4R,5S,6S)-2,2-ditert-butyl-4-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 11037853 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (4R,5S,6S)-2,2-ditert-butyl-4-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinane |
| SMILES | C=C/C=C\[C@@H](C)[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]([C@H](C)COCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C28H46O3Si/c1-11-12-16-21(2)25-23(4)26(22(3)19-29-20-24-17-14-13-15-18-24)31-32(30-25,27(5,6)7)28(8,9)10/h11-18,21-23,25-26H,1,19-20H2,2-10H3/b16-12-/t21-,22-,23+,25-,26+/m1/s1 |
| InChIKey | GCHIMPXWXSDMPJ-NMSPWPMOSA-N |
| XLogP | 7.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|