C27H36O2 — CID 71817676
(R)-[(3R,5S,6S)-5-[(E)-non-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol (PubChem CID 71817676) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is (R)-[(3R,5S,6S)-5-[(E)-non-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol.
| Compound Name | (R)-[(3R,5S,6S)-5-[(E)-non-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 71817676 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (R)-[(3R,5S,6S)-5-[(E)-non-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol |
| SMILES | CCCCCC/C=C/C[C@H]1C[C@@H]([C@@H](O)c2ccccc2)CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H36O2/c1-2-3-4-5-6-7-10-19-24-20-25(26(28)22-15-11-8-12-16-22)21-29-27(24)23-17-13-9-14-18-23/h7-18,24-28H,2-6,19-21H2,1H3/b10-7+/t24-,25+,26-,27+/m0/s1 |
| InChIKey | CKOJMIMSUCPIPR-IMHLBWHJSA-N |
| XLogP | 7.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|