C23H38O3S2Si — CID 102505084
tert-butyl-dimethyl-[(2R)-1-[2-[[(2R)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane (PubChem CID 102505084) has the molecular formula C23H38O3S2Si and a molecular weight of 454.77 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-1-[2-[[(2R)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R)-1-[2-[[(2R)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane |
|---|---|
| PubChem CID | 102505084 |
| Molecular Formula | C23H38O3S2Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-1-[2-[[(2R)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](COCc1ccccc1)CC1(C[C@@H]2CO2)SCCCS1 |
| InChI | InChI=1S/C23H38O3S2Si/c1-22(2,3)29(4,5)26-21(17-24-16-19-10-7-6-8-11-19)15-23(14-20-18-25-20)27-12-9-13-28-23/h6-8,10-11,20-21H,9,12-18H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | OAKGDGYAFDGBPA-NHCUHLMSSA-N |
| XLogP | 6.34 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|