C25H42O3S2Si — CID 135010330
tert-butyl-dimethyl-[(2S)-1-[2-[[(2S)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-5-phenylmethoxypentan-2-yl]oxysilane (PubChem CID 135010330) has the molecular formula C25H42O3S2Si and a molecular weight of 482.83 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-1-[2-[[(2S)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-5-phenylmethoxypentan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-1-[2-[[(2S)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-5-phenylmethoxypentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 135010330 |
| Molecular Formula | C25H42O3S2Si |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-1-[2-[[(2S)-oxiran-2-yl]methyl]-1,3-dithian-2-yl]-5-phenylmethoxypentan-2-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCCOCc1ccccc1)CC1(C[C@H]2CO2)SCCCS1 |
| InChI | InChI=1S/C25H42O3S2Si/c1-24(2,3)31(4,5)28-22(13-9-14-26-19-21-11-7-6-8-12-21)17-25(18-23-20-27-23)29-15-10-16-30-25/h6-8,11-12,22-23H,9-10,13-20H2,1-5H3/t22-,23-/m0/s1 |
| InChIKey | WESNDBPBFGHFBR-GOTSBHOMSA-N |
| XLogP | 7.12 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|