C27H46O5Si — CID 10885293
methyl 2-[(2R,3S,4S,6S)-3-methyl-6-(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 10885293) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4S,6S)-3-methyl-6-(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,4S,6S)-3-methyl-6-(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 10885293 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | methyl 2-[(2R,3S,4S,6S)-3-methyl-6-(2-phenylmethoxyethyl)-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@@H](CCOCc2ccccc2)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C |
| InChI | InChI=1S/C27H46O5Si/c1-19(2)33(20(3)4,21(5)6)32-26-16-24(31-25(22(26)7)17-27(28)29-8)14-15-30-18-23-12-10-9-11-13-23/h9-13,19-22,24-26H,14-18H2,1-8H3/t22-,24-,25+,26-/m0/s1 |
| InChIKey | BWQMUOHTBQMGKI-MNPUUQGPSA-N |
| XLogP | 6.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|