C20H24O10 — CID 11189432
methyl (2S,3S,4S,5R)-3,5,6-triacetyloxy-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 11189432) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-3,5,6-triacetyloxy-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-3,5,6-triacetyloxy-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11189432 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl (2S,3S,4S,5R)-3,5,6-triacetyloxy-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H](OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H24O10/c1-11(21)27-16-15(26-10-14-8-6-5-7-9-14)18(28-12(2)22)20(29-13(3)23)30-17(16)19(24)25-4/h5-9,15-18,20H,10H2,1-4H3/t15-,16-,17-,18+,20?/m0/s1 |
| InChIKey | VABBQXYOQPFBJO-YLQJXANPSA-N |
| XLogP | 0.90 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|