C25H33O7Si- — CID 134940702
(1S,4S,6R,7R,8S,10S,11E)-1-benzoyloxy-11-ethylidene-6-methyl-9-oxo-8-triethylsilyloxy-3,5-dioxatricyclo[5.2.2.04,8]undecan-10-olate (PubChem CID 134940702) has the molecular formula C25H33O7Si- and a molecular weight of 473.62 g/mol. Its IUPAC name is (1S,4S,6R,7R,8S,10S,11E)-1-benzoyloxy-11-ethylidene-6-methyl-9-oxo-8-triethylsilyloxy-3,5-dioxatricyclo[5.2.2.04,8]undecan-10-olate.
| Compound Name | (1S,4S,6R,7R,8S,10S,11E)-1-benzoyloxy-11-ethylidene-6-methyl-9-oxo-8-triethylsilyloxy-3,5-dioxatricyclo[5.2.2.04,8]undecan-10-olate |
|---|---|
| PubChem CID | 134940702 |
| Molecular Formula | C25H33O7Si- |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1S,4S,6R,7R,8S,10S,11E)-1-benzoyloxy-11-ethylidene-6-methyl-9-oxo-8-triethylsilyloxy-3,5-dioxatricyclo[5.2.2.04,8]undecan-10-olate |
| SMILES | C/C=C1\[C@@H]2[C@@H](C)O[C@@H]3OC[C@@](OC(=O)c4ccccc4)(C(=O)[C@@]32O[Si](CC)(CC)CC)[C@H]1[O-] |
| InChI | InChI=1S/C25H33O7Si/c1-6-18-19-16(5)30-23-25(19,32-33(7-2,8-3)9-4)22(28)24(15-29-23,20(18)26)31-21(27)17-13-11-10-12-14-17/h6,10-14,16,19-20,23H,7-9,15H2,1-5H3/q-1/b18-6+/t16-,19+,20+,23+,24+,25-/m1/s1 |
| InChIKey | WJSGZWSTFXWJLN-LNKCCNLOSA-N |
| XLogP | 2.99 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|