C22H32O7Si — CID 135022462
(3R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one (PubChem CID 135022462) has the molecular formula C22H32O7Si and a molecular weight of 436.58 g/mol. Its IUPAC name is (3R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one.
| Compound Name | (3R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one |
|---|---|
| PubChem CID | 135022462 |
| Molecular Formula | C22H32O7Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one |
| SMILES | CO[C@@]12CC(=O)OC1C(O[Si](C)(C)C(C)(C)C)[C@@H]1OC(c3ccccc3)OCC1O2 |
| InChI | InChI=1S/C22H32O7Si/c1-21(2,3)30(5,6)29-18-17-15(28-22(24-4)12-16(23)26-19(18)22)13-25-20(27-17)14-10-8-7-9-11-14/h7-11,15,17-20H,12-13H2,1-6H3/t15?,17-,18?,19?,20?,22-/m1/s1 |
| InChIKey | NIVICVYMDWUJJU-IBUPICNKSA-N |
| XLogP | 3.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|