C23H32O6Si — CID 11235832
(1S,3R,6R,8R,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-12-one (PubChem CID 11235832) has the molecular formula C23H32O6Si and a molecular weight of 432.59 g/mol. Its IUPAC name is (1S,3R,6R,8R,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-12-one.
| Compound Name | (1S,3R,6R,8R,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-12-one |
|---|---|
| PubChem CID | 11235832 |
| Molecular Formula | C23H32O6Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (1S,3R,6R,8R,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,5,7,11-tetraoxatricyclo[8.5.0.03,8]pentadec-13-en-12-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2OC(=O)C=CC[C@@H]2O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C23H32O6Si/c1-23(2,3)30(4,5)29-21-19-16(12-9-13-18(24)27-19)26-17-14-25-22(28-20(17)21)15-10-7-6-8-11-15/h6-11,13,16-17,19-22H,12,14H2,1-5H3/t16-,17+,19-,20+,21+,22+/m0/s1 |
| InChIKey | LNGLNXIFLLHLJP-QRGGPHLOSA-N |
| XLogP | 4.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|