C26H32O6 — CID 11385147
ethyl 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetate (PubChem CID 11385147) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetate.
| Compound Name | ethyl 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 11385147 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | ethyl 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@H](C[C@@H]2C[C@H](C)O[C@H](c3ccccc3)O2)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C26H32O6/c1-3-28-24(27)17-23-16-22(31-26(32-23)20-12-8-5-9-13-20)15-21-14-18(2)29-25(30-21)19-10-6-4-7-11-19/h4-13,18,21-23,25-26H,3,14-17H2,1-2H3/t18-,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | XULNLWOJRBFYQH-ALRJODRESA-N |
| XLogP | 5.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |