C31H33BrF2HgO6 — CID 134880847
bromo-[[(2R,3S,4R,5R,6R)-6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]mercury (PubChem CID 134880847) has the molecular formula C31H33BrF2HgO6 and a molecular weight of 820.09 g/mol. Its IUPAC name is bromo-[[(2R,3S,4R,5R,6R)-6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]mercury.
| Compound Name | bromo-[[(2R,3S,4R,5R,6R)-6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]mercury |
|---|---|
| PubChem CID | 134880847 |
| Molecular Formula | C31H33BrF2HgO6 |
| Molecular Weight | 820.09 g/mol |
| Exact Mass | 820.11 |
| IUPAC Name | bromo-[[(2R,3S,4R,5R,6R)-6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]mercury |
| SMILES | CCOC(=O)C(F)(F)[C@@H]1O[C@@H](C[Hg]Br)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H33F2O6.BrH.Hg/c1-3-35-30(34)31(32,33)29-28(38-21-25-17-11-6-12-18-25)27(37-20-24-15-9-5-10-16-24)26(22(2)39-29)36-19-23-13-7-4-8-14-23;;/h4-18,22,26-29H,2-3,19-21H2,1H3;1H;/q;;+1/p-1/t22-,26+,27-,28+,29+;;/m0../s1 |
| InChIKey | UCBMCGZDPVMXKO-HJPFXZBRSA-M |
| XLogP | 6.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.09 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|