C32H29F7O5 — CID 12994455
(E)-1-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-3,4,5,5,6,6,6-heptafluorohex-3-en-2-one (PubChem CID 12994455) has the molecular formula C32H29F7O5 and a molecular weight of 626.57 g/mol. Its IUPAC name is (E)-1-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-3,4,5,5,6,6,6-heptafluorohex-3-en-2-one.
| Compound Name | (E)-1-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-3,4,5,5,6,6,6-heptafluorohex-3-en-2-one |
|---|---|
| PubChem CID | 12994455 |
| Molecular Formula | C32H29F7O5 |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | (E)-1-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-3,4,5,5,6,6,6-heptafluorohex-3-en-2-one |
| SMILES | O=C(C[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1)/C(F)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H29F7O5/c33-27(30(34)31(35,36)32(37,38)39)24(40)16-25-28(42-18-22-12-6-2-7-13-22)29(43-19-23-14-8-3-9-15-23)26(44-25)20-41-17-21-10-4-1-5-11-21/h1-15,25-26,28-29H,16-20H2/b30-27+/t25-,26+,28-,29+/m0/s1 |
| InChIKey | BAAIARJXXODOMC-DMSVOYADSA-N |
| XLogP | 7.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|