C33H34N4O2S — CID 10864571
[4-[(5Z)-5-[(E)-3-[4-(dibutylamino)phenyl]prop-2-enylidene]-2-(dicyanomethylidene)-1,3-thiazol-4-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 10864571) has the molecular formula C33H34N4O2S and a molecular weight of 550.73 g/mol. Its IUPAC name is [4-[(5Z)-5-[(E)-3-[4-(dibutylamino)phenyl]prop-2-enylidene]-2-(dicyanomethylidene)-1,3-thiazol-4-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[(5Z)-5-[(E)-3-[4-(dibutylamino)phenyl]prop-2-enylidene]-2-(dicyanomethylidene)-1,3-thiazol-4-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10864571 |
| Molecular Formula | C33H34N4O2S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [4-[(5Z)-5-[(E)-3-[4-(dibutylamino)phenyl]prop-2-enylidene]-2-(dicyanomethylidene)-1,3-thiazol-4-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2nc(=C(C#N)C#N)s/c2=C\C=C\c2ccc(N(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O2S/c1-5-7-20-37(21-8-6-2)28-16-12-25(13-17-28)10-9-11-30-31(36-32(40-30)27(22-34)23-35)26-14-18-29(19-15-26)39-33(38)24(3)4/h9-19H,3,5-8,20-21H2,1-2,4H3/b10-9+,30-11- |
| InChIKey | ITHDFLUWHCWSLW-BQVJOHQZSA-N |
| XLogP | 6.39 |
| TPSA | 90.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|