C30H33ClN4O2S — CID 43833646
2-[(5E)-4-[4-(3-chloro-2-hydroxypropoxy)phenyl]-5-[[4-(dibutylamino)phenyl]methylidene]-1,3-thiazol-2-ylidene]propanedinitrile (PubChem CID 43833646) has the molecular formula C30H33ClN4O2S and a molecular weight of 549.14 g/mol. Its IUPAC name is 2-[(5E)-4-[4-(3-chloro-2-hydroxypropoxy)phenyl]-5-[[4-(dibutylamino)phenyl]methylidene]-1,3-thiazol-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-4-[4-(3-chloro-2-hydroxypropoxy)phenyl]-5-[[4-(dibutylamino)phenyl]methylidene]-1,3-thiazol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 43833646 |
| Molecular Formula | C30H33ClN4O2S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2-[(5E)-4-[4-(3-chloro-2-hydroxypropoxy)phenyl]-5-[[4-(dibutylamino)phenyl]methylidene]-1,3-thiazol-2-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=c2/sc(=C(C#N)C#N)nc2-c2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C30H33ClN4O2S/c1-3-5-15-35(16-6-4-2)25-11-7-22(8-12-25)17-28-29(34-30(38-28)24(19-32)20-33)23-9-13-27(14-10-23)37-21-26(36)18-31/h7-14,17,26,36H,3-6,15-16,18,21H2,1-2H3/b28-17+ |
| InChIKey | FWIPUONHRQPAGE-OGLMXYFKSA-N |
| XLogP | 5.22 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|