C44H49N3O — CID 50936665
4-[(E)-2-[5-[(E)-2-(4-hexoxyphenyl)ethenyl]-3,6-diphenylpyrazin-2-yl]ethenyl]-N,N-dipropylaniline (PubChem CID 50936665) has the molecular formula C44H49N3O and a molecular weight of 635.90 g/mol. Its IUPAC name is 4-[(E)-2-[5-[(E)-2-(4-hexoxyphenyl)ethenyl]-3,6-diphenylpyrazin-2-yl]ethenyl]-N,N-dipropylaniline.
| Compound Name | 4-[(E)-2-[5-[(E)-2-(4-hexoxyphenyl)ethenyl]-3,6-diphenylpyrazin-2-yl]ethenyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 50936665 |
| Molecular Formula | C44H49N3O |
| Molecular Weight | 635.90 g/mol |
| Exact Mass | 635.39 |
| IUPAC Name | 4-[(E)-2-[5-[(E)-2-(4-hexoxyphenyl)ethenyl]-3,6-diphenylpyrazin-2-yl]ethenyl]-N,N-dipropylaniline |
| SMILES | CCCCCCOc1ccc(/C=C/c2nc(-c3ccccc3)c(/C=C/c3ccc(N(CCC)CCC)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C44H49N3O/c1-4-7-8-15-34-48-40-28-22-36(23-29-40)25-31-42-44(38-18-13-10-14-19-38)45-41(43(46-42)37-16-11-9-12-17-37)30-24-35-20-26-39(27-21-35)47(32-5-2)33-6-3/h9-14,16-31H,4-8,15,32-34H2,1-3H3/b30-24+,31-25+ |
| InChIKey | GAPRJNXCVQTHGL-AMLXCYGQSA-N |
| XLogP | 11.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.90 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|