C44H46O8 — CID 10865399
(2R,3S,4S,5R)-3-[(2S)-2,3-bis(phenylmethoxy)propoxy]-2-hydroxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclopentan-1-one (PubChem CID 10865399) has the molecular formula C44H46O8 and a molecular weight of 702.84 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[(2S)-2,3-bis(phenylmethoxy)propoxy]-2-hydroxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclopentan-1-one.
| Compound Name | (2R,3S,4S,5R)-3-[(2S)-2,3-bis(phenylmethoxy)propoxy]-2-hydroxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 10865399 |
| Molecular Formula | C44H46O8 |
| Molecular Weight | 702.84 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | (2R,3S,4S,5R)-3-[(2S)-2,3-bis(phenylmethoxy)propoxy]-2-hydroxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)cyclopentan-1-one |
| SMILES | O=C1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OC[C@H](COCc2ccccc2)OCc2ccccc2)[C@]1(O)COCc1ccccc1 |
| InChI | InChI=1S/C44H46O8/c45-42-40(50-29-37-22-12-4-13-23-37)41(51-30-38-24-14-5-15-25-38)43(44(42,46)33-48-27-35-18-8-2-9-19-35)52-32-39(49-28-36-20-10-3-11-21-36)31-47-26-34-16-6-1-7-17-34/h1-25,39-41,43,46H,26-33H2/t39-,40+,41+,43-,44-/m0/s1 |
| InChIKey | RPIFZLSXCUUHET-ILRJTEGBSA-N |
| XLogP | 6.88 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.84 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |