C20H24O5S — CID 86674672
1-[(2R)-2,3-bis(phenylmethoxy)propyl]cyclopropane-1-sulfonic acid (PubChem CID 86674672) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is 1-[(2R)-2,3-bis(phenylmethoxy)propyl]cyclopropane-1-sulfonic acid.
| Compound Name | 1-[(2R)-2,3-bis(phenylmethoxy)propyl]cyclopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 86674672 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[(2R)-2,3-bis(phenylmethoxy)propyl]cyclopropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1(C[C@H](COCc2ccccc2)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24O5S/c21-26(22,23)20(11-12-20)13-19(25-15-18-9-5-2-6-10-18)16-24-14-17-7-3-1-4-8-17/h1-10,19H,11-16H2,(H,21,22,23)/t19-/m1/s1 |
| InChIKey | WVZQYBQNRPNDSO-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|