C28H33N9O12S4 — CID 10865717
2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 10865717) has the molecular formula C28H33N9O12S4 and a molecular weight of 815.89 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 10865717 |
| Molecular Formula | C28H33N9O12S4 |
| Molecular Weight | 815.89 g/mol |
| Exact Mass | 815.11 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1nc2ccc(NC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)Nc3ccc4nc(S(N)(=O)=O)sc4c3)CC(=O)O)CC(=O)O)cc2s1 |
| InChI | InChI=1S/C28H33N9O12S4/c29-52(46,47)27-33-18-3-1-16(9-20(18)50-27)31-22(38)11-36(14-25(42)43)7-5-35(13-24(40)41)6-8-37(15-26(44)45)12-23(39)32-17-2-4-19-21(10-17)51-28(34-19)53(30,48)49/h1-4,9-10H,5-8,11-15H2,(H,31,38)(H,32,39)(H,40,41)(H,42,43)(H,44,45)(H2,29,46,47)(H2,30,48,49) |
| InChIKey | VTXPJLWYFJDDQR-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 325.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.89 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |