C22H20ClNO5 — CID 108663538
[4-[(3Z)-3-[(3-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663538) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is [4-[(3Z)-3-[(3-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-3-[(3-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663538 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [4-[(3Z)-3-[(3-chlorophenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2cccc(Cl)c2)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C22H20ClNO5/c1-3-11-24-19(14-7-9-17(10-8-14)29-13(2)25)18(21(27)22(24)28)20(26)15-5-4-6-16(23)12-15/h4-10,12,19,26H,3,11H2,1-2H3/b20-18- |
| InChIKey | GXIBWNFMJGRONL-ZZEZOPTASA-N |
| XLogP | 4.10 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|