C27H21BrN2O5 — CID 108668152
4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(2,3-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108668152) has the molecular formula C27H21BrN2O5 and a molecular weight of 533.38 g/mol. Its IUPAC name is 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(2,3-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(2,3-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108668152 |
| Molecular Formula | C27H21BrN2O5 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(2,3-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | COc1cccc(C2/C(=C(/O)c3ccc(Br)c(C)c3)C(=O)C(=O)N2c2ccc(C#N)cc2)c1OC |
| InChI | InChI=1S/C27H21BrN2O5/c1-15-13-17(9-12-20(15)28)24(31)22-23(19-5-4-6-21(34-2)26(19)35-3)30(27(33)25(22)32)18-10-7-16(14-29)8-11-18/h4-13,23,31H,1-3H3/b24-22- |
| InChIKey | LKNODNVXDKTEHN-GYHWCHFESA-N |
| XLogP | 5.27 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|