About 1-iodohexan-2-ol
1-iodohexan-2-ol (PubChem CID 10868036) has the molecular formula C6H13IO
and a molecular weight of 228.07 g/mol. Its IUPAC name is 1-iodohexan-2-ol.
Molecular Properties
| Compound Name | 1-iodohexan-2-ol |
| PubChem CID | 10868036 |
| Molecular Formula | C6H13IO |
| Molecular Weight | 228.07 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 1-iodohexan-2-ol |
| SMILES | CCCCC(O)CI |
| InChI | InChI=1S/C6H13IO/c1-2-3-4-6(8)5-7/h6,8H,2-5H2,1H3 |
| InChIKey | SGIKBHPMPRZXCQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.07 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodohexan-2-ol?
The IUPAC name of 1-iodohexan-2-ol (CID 10868036) is 1-iodohexan-2-ol.
What is the SMILES notation for 1-iodohexan-2-ol?
The canonical SMILES for 1-iodohexan-2-ol is CCCCC(O)CI.
What is the InChIKey of 1-iodohexan-2-ol?
The InChIKey is SGIKBHPMPRZXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13IO/c1-2-3-4-6(8)5-7/h6,8H,2-5H2,1H3.
What are the key properties of 1-iodohexan-2-ol?
1-iodohexan-2-ol has a molecular weight of 228.07 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodohexan-2-ol is sourced from PubChem (CID 10868036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).