C6H11IO — CID 10889589
Cyclohexanol, 2-iodo-, (1R,2R)- (PubChem CID 10889589) has the molecular formula C6H11IO and a molecular weight of 226.06 g/mol. Its IUPAC name is trans-(1R,2R)-2-iodocyclohexan-1-ol.
| Compound Name | Cyclohexanol, 2-iodo-, (1R,2R)- |
|---|---|
| PubChem CID | 10889589 |
| Molecular Formula | C6H11IO |
| Molecular Weight | 226.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | trans-(1R,2R)-2-iodocyclohexan-1-ol |
| SMILES | C1CC[C@H]([C@@H](C1)O)I |
| InChI | InChI=1S/C6H11IO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | YSLIEJFPLGXOBP-PHDIDXHHSA-N |
| XLogP | 2.10 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 74 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|