C15H20O3 — CID 10868648
4-[(2E,4E)-hexa-2,4-dienoxy]-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 10868648) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-[(2E,4E)-hexa-2,4-dienoxy]-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-[(2E,4E)-hexa-2,4-dienoxy]-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 10868648 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[(2E,4E)-hexa-2,4-dienoxy]-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | C/C=C/C=C/COC1=CC(=O)OC12CCCCC2 |
| InChI | InChI=1S/C15H20O3/c1-2-3-4-8-11-17-13-12-14(16)18-15(13)9-6-5-7-10-15/h2-4,8,12H,5-7,9-11H2,1H3/b3-2+,8-4+ |
| InChIKey | BDIBDMYIXSROSF-CRBCFSCISA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|