C28H28ClNO5S — CID 108687127
(4Z)-1-(3-chloro-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108687127) has the molecular formula C28H28ClNO5S and a molecular weight of 526.05 g/mol. Its IUPAC name is (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108687127 |
| Molecular Formula | C28H28ClNO5S |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(OC)c(Cl)c3)C2c2sccc2C)cc1 |
| InChI | InChI=1S/C28H28ClNO5S/c1-4-5-6-14-35-20-10-7-18(8-11-20)25(31)23-24(27-17(2)13-15-36-27)30(28(33)26(23)32)19-9-12-22(34-3)21(29)16-19/h7-13,15-16,24,31H,4-6,14H2,1-3H3/b25-23- |
| InChIKey | KWXYJXBTBWMQQV-BZZOAKBMSA-N |
| XLogP | 6.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|