C28H33N3O7 — CID 108692232
ethyl 4-[(4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108692232) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is ethyl 4-[(4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108692232 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | ethyl 4-[(4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCC)cc3OCC)C2c2ccccn2)CC1 |
| InChI | InChI=1S/C28H33N3O7/c1-4-36-19-10-11-20(22(17-19)37-5-2)25(32)23-24(21-9-7-8-14-29-21)31(27(34)26(23)33)18-12-15-30(16-13-18)28(35)38-6-3/h7-11,14,17-18,24,32H,4-6,12-13,15-16H2,1-3H3/b25-23+ |
| InChIKey | WFZIIVRGYIQVPG-WJTDDFOZSA-N |
| XLogP | 3.92 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|