C26H27Cl2N3O7 — CID 108692805
ethyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108692805) has the molecular formula C26H27Cl2N3O7 and a molecular weight of 564.42 g/mol. Its IUPAC name is ethyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108692805 |
| Molecular Formula | C26H27Cl2N3O7 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | ethyl 4-[(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3OC)C2c2ccncc2)CC1 |
| InChI | InChI=1S/C26H27Cl2N3O7/c1-4-38-26(35)30-11-7-15(8-12-30)31-20(14-5-9-29-10-6-14)18(22(33)25(31)34)21(32)16-13-17(27)24(37-3)19(28)23(16)36-2/h5-6,9-10,13,15,20,32H,4,7-8,11-12H2,1-3H3/b21-18+ |
| InChIKey | ATQYGBUDLINCIR-DYTRJAOYSA-N |
| XLogP | 4.45 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|