C13H26O4Si — CID 10869506
(1R,2S)-1-[(2R,3R)-3-methyloxiran-2-yl]-2-(2-trimethylsilylethoxymethoxy)but-3-en-1-ol (PubChem CID 10869506) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is (1R,2S)-1-[(2R,3R)-3-methyloxiran-2-yl]-2-(2-trimethylsilylethoxymethoxy)but-3-en-1-ol.
| Compound Name | (1R,2S)-1-[(2R,3R)-3-methyloxiran-2-yl]-2-(2-trimethylsilylethoxymethoxy)but-3-en-1-ol |
|---|---|
| PubChem CID | 10869506 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1R,2S)-1-[(2R,3R)-3-methyloxiran-2-yl]-2-(2-trimethylsilylethoxymethoxy)but-3-en-1-ol |
| SMILES | C=C[C@H](OCOCC[Si](C)(C)C)[C@@H](O)[C@H]1O[C@@H]1C |
| InChI | InChI=1S/C13H26O4Si/c1-6-11(12(14)13-10(2)17-13)16-9-15-7-8-18(3,4)5/h6,10-14H,1,7-9H2,2-5H3/t10-,11+,12-,13+/m1/s1 |
| InChIKey | OVSMBELAPCXQCY-XQHKEYJVSA-N |
| XLogP | 2.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|