C14H17NO3S — CID 10869655
(3aS,6aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-one (PubChem CID 10869655) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is (3aS,6aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-one.
| Compound Name | (3aS,6aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 10869655 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (3aS,6aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3CC(=O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-10-2-4-14(5-3-10)19(17,18)15-8-11-6-13(16)7-12(11)9-15/h2-5,11-12H,6-9H2,1H3/t11-,12+ |
| InChIKey | OBQHEQBLGQCLQU-TXEJJXNPSA-N |
| XLogP | 1.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |