C25H21Cl2NO4S — CID 108696567
(4Z)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[2-(4-chlorophenyl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108696567) has the molecular formula C25H21Cl2NO4S and a molecular weight of 502.42 g/mol. Its IUPAC name is (4Z)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[2-(4-chlorophenyl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[2-(4-chlorophenyl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696567 |
| Molecular Formula | C25H21Cl2NO4S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | (4Z)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[2-(4-chlorophenyl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2/C(=O)C(=O)N(CCc3ccc(Cl)cc3)C2c2sccc2C)ccc1Cl |
| InChI | InChI=1S/C25H21Cl2NO4S/c1-14-10-12-33-24(14)21-20(22(29)16-5-8-18(27)19(13-16)32-2)23(30)25(31)28(21)11-9-15-3-6-17(26)7-4-15/h3-8,10,12-13,21,29H,9,11H2,1-2H3/b22-20- |
| InChIKey | ADGKWLXFLVZJFB-XDOYNYLZSA-N |
| XLogP | 6.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|